| Drugbox
| Verifiedfields = changed
| verifiedrevid = 464214968
| IUPAC_name = 2-chloro-10-[3-(4-methyl-1-piperazinyl)propyl]-10H-phenothiazine
| image = Prochlorperazine.svg
| tradename =
| Drugs.com =| MedlinePlus = a682116
| pregnancy_category = C (Au, U.S.)
| legal_US = Rx-only
| legal_status = OTC/POM (UK)
| routes_of_administration = Oral, buccal, rectal, IM
| bioavailability = not exactly known, but substantial
| protein_bound = 91-99%
| metabolism = Mainly hepatic (CYP2D6 and/or CYP3A4)
| elimination_half-life = 4-8 hoursS, differs with the method of administration
| excretion = Biliary, (colored) inactive metabolites in urine
| CASNo_Ref =| CAS_number_Ref =| CAS_number = 58-38-8
| ATC_prefix = N05
| ATC_suffix = AB04
| PubChem = 4917
| DrugBank_Ref =| DrugBank = APRD00624
| ChemSpiderID_Ref =| ChemSpiderID = 4748
| UNII_Ref =| UNII = YHP6YLT61T
| KEGG_Ref =| KEGG = D00493
| ChEBI_Ref =| ChEBI = 8435
| ChEMBL_Ref =| ChEMBL = 728
| C=20 | H=24 | Cl=1 | N=3 | S=1
| molecular_weight = 373.943 g/mol
| smiles = Clc2cc1N(c3c(Sc1cc2)cccc3)CCCN4CCN(C)CC4
| InChI = 1/C20H24ClN3S/c1-22-11-13-23(14-12-22)9-4-10-24-17-5-2-3-6-19(17)25-20-8-7-16(21)15-18(20)24/h2-3,5-8,15H,4,9-14H2,1H3
| InChIKey = WIKYUJGCLQQFNW-UHFFFAOYAF
| StdInChI_Ref =| StdInChI = 1S/C20H24ClN3S/c1-22-11-13-23(14-12-22)9-4-10-24-17-5-2-3-6-19(17)25-20-8-7-16(21)15-18(20)24/h2-3,5-8,15H,4,9-14H2,1H3
| StdInChIKey_Ref =| StdInChIKey = WIKYUJGCLQQFNW-UHFFFAOYSA-N
Prochlorperazine Compazine , Stemzine , Buccastem , Stemetil , Phenotil ) is a dopamine (D2) receptor antagonist that belongs to the phenothiazine class of antipsychotic agents that are used for the antiemetic treatment of nausea and vertigo. It is also a highly-potent typical antipsychotic, 10-20x more potent than chlorpromazine. It is also used to treat migraine headaches. Intravenous administration can be used to treat status migrainosus. |
